C8H11NS2 — CID 162471297
5-methyl-2,3,3a,4-tetrahydrothieno[3,2-c]pyridine-6-thione (PubChem CID 162471297) has the molecular formula C8H11NS2 and a molecular weight of 185.32 g/mol. Its IUPAC name is 5-methyl-2,3,3a,4-tetrahydrothieno[3,2-c]pyridine-6-thione.
| Compound Name | 5-methyl-2,3,3a,4-tetrahydrothieno[3,2-c]pyridine-6-thione |
|---|---|
| PubChem CID | 162471297 |
| Molecular Formula | C8H11NS2 |
| Molecular Weight | 185.32 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 5-methyl-2,3,3a,4-tetrahydrothieno[3,2-c]pyridine-6-thione |
| SMILES | CN1CC2CCSC2=CC1=S |
| InChI | InChI=1S/C8H11NS2/c1-9-5-6-2-3-11-7(6)4-8(9)10/h4,6H,2-3,5H2,1H3 |
| InChIKey | AZJMRRRMEBIELB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|