About 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine
3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine (PubChem CID 57227293) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine.
Analyze 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine?
The IUPAC name of 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine (CID 57227293) is 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine.
What is the SMILES notation for 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine?
The canonical SMILES for 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine is CN1CCC(C2=CCCS2)C1.
What is the InChIKey of 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine?
The InChIKey is DCBDQWSGQMSERM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS/c1-10-5-4-8(7-10)9-3-2-6-11-9/h3,8H,2,4-7H2,1H3.
What are the key properties of 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine?
3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine has a molecular weight of 169.29 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydrothiophen-5-yl)-1-methylpyrrolidine is sourced from PubChem (CID 57227293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).