C9H11NS3 — CID 170193873
(3aR)-5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 170193873) has the molecular formula C9H11NS3 and a molecular weight of 229.39 g/mol. Its IUPAC name is (3aR)-5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | (3aR)-5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 170193873 |
| Molecular Formula | C9H11NS3 |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | (3aR)-5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CCN1C(=S)C=C2SCC[C@H]2C1=S |
| InChI | InChI=1S/C9H11NS3/c1-2-10-8(11)5-7-6(9(10)12)3-4-13-7/h5-6H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | GTXQJTAVLSSEPG-ZCFIWIBFSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|