C9H13NS3 — CID 142135778
3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione;ethane (PubChem CID 142135778) has the molecular formula C9H13NS3 and a molecular weight of 231.41 g/mol. Its IUPAC name is 3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione;ethane.
| Compound Name | 3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione;ethane |
|---|---|
| PubChem CID | 142135778 |
| Molecular Formula | C9H13NS3 |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione;ethane |
| SMILES | CC.S=C1C=C2SCCC2C(=S)N1 |
| InChI | InChI=1S/C7H7NS3.C2H6/c9-6-3-5-4(1-2-11-5)7(10)8-6;1-2/h3-4H,1-2H2,(H,8,9,10);1-2H3 |
| InChIKey | CCHSQFDERGEGPF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|