C11H17NS3 — CID 143080088
ethane;6-methyl-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5,7-dithione (PubChem CID 143080088) has the molecular formula C11H17NS3 and a molecular weight of 259.46 g/mol. Its IUPAC name is ethane;6-methyl-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5,7-dithione.
| Compound Name | ethane;6-methyl-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5,7-dithione |
|---|---|
| PubChem CID | 143080088 |
| Molecular Formula | C11H17NS3 |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | ethane;6-methyl-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5,7-dithione |
| SMILES | CC.CN1C(=S)C=C2SCCCC2C1=S |
| InChI | InChI=1S/C9H11NS3.C2H6/c1-10-8(11)5-7-6(9(10)12)3-2-4-13-7;1-2/h5-6H,2-4H2,1H3;1-2H3 |
| InChIKey | ZXXWGJLQYPMNNS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|