C24H36N4O3S2 — CID 143080263
acetylene;(E)-2-[[5-[cyclopropyl(methyl)amino]sulfanyl-4-hydroxythiophen-3-yl]amino]-3-methoxy-N'-[(4-propan-2-ylfuran-2-yl)methyl]prop-2-enimidamide;ethane (PubChem CID 143080263) has the molecular formula C24H36N4O3S2 and a molecular weight of 492.71 g/mol. Its IUPAC name is acetylene;(E)-2-[[5-[cyclopropyl(methyl)amino]sulfanyl-4-hydroxythiophen-3-yl]amino]-3-methoxy-N'-[(4-propan-2-ylfuran-2-yl)methyl]prop-2-enimidamide;ethane.
| Compound Name | acetylene;(E)-2-[[5-[cyclopropyl(methyl)amino]sulfanyl-4-hydroxythiophen-3-yl]amino]-3-methoxy-N'-[(4-propan-2-ylfuran-2-yl)methyl]prop-2-enimidamide;ethane |
|---|---|
| PubChem CID | 143080263 |
| Molecular Formula | C24H36N4O3S2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | acetylene;(E)-2-[[5-[cyclopropyl(methyl)amino]sulfanyl-4-hydroxythiophen-3-yl]amino]-3-methoxy-N'-[(4-propan-2-ylfuran-2-yl)methyl]prop-2-enimidamide;ethane |
| SMILES | C#C.CC.CO/C=C(Nc1csc(SN(C)C2CC2)c1O)\C(N)=N\Cc1cc(C(C)C)co1 |
| InChI | InChI=1S/C20H28N4O3S2.C2H6.C2H2/c1-12(2)13-7-15(27-9-13)8-22-19(21)16(10-26-4)23-17-11-28-20(18(17)25)29-24(3)14-5-6-14;2*1-2/h7,9-12,14,23,25H,5-6,8H2,1-4H3,(H2,21,22);1-2H3;1-2H/b16-10+;; |
| InChIKey | IRNQUDQMYNDXAC-CNSDMJOKSA-N |
| XLogP | 6.00 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|