C20H31N5O2S3 — CID 143076596
2-[cyclopropyl(methyl)amino]sulfanyl-4-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol;ethane (PubChem CID 143076596) has the molecular formula C20H31N5O2S3 and a molecular weight of 469.70 g/mol. Its IUPAC name is 2-[cyclopropyl(methyl)amino]sulfanyl-4-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol;ethane.
| Compound Name | 2-[cyclopropyl(methyl)amino]sulfanyl-4-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol;ethane |
|---|---|
| PubChem CID | 143076596 |
| Molecular Formula | C20H31N5O2S3 |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-[cyclopropyl(methyl)amino]sulfanyl-4-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol;ethane |
| SMILES | CC.CC.Cc1ccc(CNc2nsnc2Nc2csc(SN(C)C3CC3)c2O)o1 |
| InChI | InChI=1S/C16H19N5O2S3.2C2H6/c1-9-3-6-11(23-9)7-17-14-15(20-26-19-14)18-12-8-24-16(13(12)22)25-21(2)10-4-5-10;2*1-2/h3,6,8,10,22H,4-5,7H2,1-2H3,(H,17,19)(H,18,20);2*1-2H3 |
| InChIKey | UZLICEOAWHXRJY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|