C17H23N5O3S — CID 143076764
(2Z,5E)-3-hydroxy-2-methyl-5-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]octa-2,5-dienamide (PubChem CID 143076764) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol. Its IUPAC name is (2Z,5E)-3-hydroxy-2-methyl-5-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]octa-2,5-dienamide.
| Compound Name | (2Z,5E)-3-hydroxy-2-methyl-5-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]octa-2,5-dienamide |
|---|---|
| PubChem CID | 143076764 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (2Z,5E)-3-hydroxy-2-methyl-5-[[4-[(5-methylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]octa-2,5-dienamide |
| SMILES | CC/C=C(\C/C(O)=C(\C)C(N)=O)Nc1nsnc1NCc1ccc(C)o1 |
| InChI | InChI=1S/C17H23N5O3S/c1-4-5-12(8-14(23)11(3)15(18)24)20-17-16(21-26-22-17)19-9-13-7-6-10(2)25-13/h5-7,23H,4,8-9H2,1-3H3,(H2,18,24)(H,19,21)(H,20,22)/b12-5+,14-11- |
| InChIKey | FPGYYPOSBPIUFZ-SFSZHSGXSA-N |
| XLogP | 3.46 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|