C20H26F6N2O — CID 143080625
acetylene;cis-(1S,3R)-3-amino-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]cyclopentane-1-carboxamide;propane (PubChem CID 143080625) has the molecular formula C20H26F6N2O and a molecular weight of 424.43 g/mol. Its IUPAC name is acetylene;cis-(1S,3R)-3-amino-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]cyclopentane-1-carboxamide;propane.
| Compound Name | acetylene;cis-(1S,3R)-3-amino-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]cyclopentane-1-carboxamide;propane |
|---|---|
| PubChem CID | 143080625 |
| Molecular Formula | C20H26F6N2O |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | acetylene;cis-(1S,3R)-3-amino-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]cyclopentane-1-carboxamide;propane |
| SMILES | C#C.CCC.N[C@@H]1CC[C@H](C(=O)NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H16F6N2O.C3H8.C2H2/c16-14(17,18)10-3-8(4-11(6-10)15(19,20)21)7-23-13(24)9-1-2-12(22)5-9;1-3-2;1-2/h3-4,6,9,12H,1-2,5,7,22H2,(H,23,24);3H2,1-2H3;1-2H/t9-,12+;;/m0../s1 |
| InChIKey | CVEHIJMIUADTQD-FAJLARSSSA-N |
| XLogP | 5.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|