C25H34F6N2O2 — CID 142976775
acetylene;cis-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(oxan-4-ylamino)cyclopentane-1-carboxamide;propane (PubChem CID 142976775) has the molecular formula C25H34F6N2O2 and a molecular weight of 508.55 g/mol. Its IUPAC name is acetylene;cis-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(oxan-4-ylamino)cyclopentane-1-carboxamide;propane.
| Compound Name | acetylene;cis-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(oxan-4-ylamino)cyclopentane-1-carboxamide;propane |
|---|---|
| PubChem CID | 142976775 |
| Molecular Formula | C25H34F6N2O2 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | acetylene;cis-(1S,3R)-N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(oxan-4-ylamino)cyclopentane-1-carboxamide;propane |
| SMILES | C#C.CCC.O=C(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1CC[C@@H](NC2CCOCC2)C1 |
| InChI | InChI=1S/C20H24F6N2O2.C3H8.C2H2/c21-19(22,23)14-7-12(8-15(10-14)20(24,25)26)11-27-18(29)13-1-2-17(9-13)28-16-3-5-30-6-4-16;1-3-2;1-2/h7-8,10,13,16-17,28H,1-6,9,11H2,(H,27,29);3H2,1-2H3;1-2H/t13-,17+;;/m0../s1 |
| InChIKey | NPHYLMJBEVFLPA-YUANJJMISA-N |
| XLogP | 5.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|