C23H32F3N5O2 — CID 142976918
cis-(1S,3R)-N-[[3-[(E)-(methyldiazenyl)methyliminomethyl]-5-(trifluoromethyl)phenyl]methyl]-3-[methyl(oxan-4-yl)amino]cyclopentane-1-carboxamide (PubChem CID 142976918) has the molecular formula C23H32F3N5O2 and a molecular weight of 467.54 g/mol. Its IUPAC name is cis-(1S,3R)-N-[[3-[(E)-(methyldiazenyl)methyliminomethyl]-5-(trifluoromethyl)phenyl]methyl]-3-[methyl(oxan-4-yl)amino]cyclopentane-1-carboxamide.
| Compound Name | cis-(1S,3R)-N-[[3-[(E)-(methyldiazenyl)methyliminomethyl]-5-(trifluoromethyl)phenyl]methyl]-3-[methyl(oxan-4-yl)amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 142976918 |
| Molecular Formula | C23H32F3N5O2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | cis-(1S,3R)-N-[[3-[(E)-(methyldiazenyl)methyliminomethyl]-5-(trifluoromethyl)phenyl]methyl]-3-[methyl(oxan-4-yl)amino]cyclopentane-1-carboxamide |
| SMILES | C/N=N/C/N=C/c1cc(CNC(=O)[C@H]2CC[C@@H](N(C)C3CCOCC3)C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H32F3N5O2/c1-27-30-15-28-13-16-9-17(11-19(10-16)23(24,25)26)14-29-22(32)18-3-4-21(12-18)31(2)20-5-7-33-8-6-20/h9-11,13,18,20-21H,3-8,12,14-15H2,1-2H3,(H,29,32)/b28-13+,30-27+/t18-,21+/m0/s1 |
| InChIKey | XRLDUDSXWRWJAP-UMDYTNFMSA-N |
| XLogP | 4.06 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|