C16H15F6NO — CID 59888732
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methylidenecyclopentane-1-carboxamide (PubChem CID 59888732) has the molecular formula C16H15F6NO and a molecular weight of 351.29 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methylidenecyclopentane-1-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methylidenecyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 59888732 |
| Molecular Formula | C16H15F6NO |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methylidenecyclopentane-1-carboxamide |
| SMILES | C=C1CCC(C(=O)NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H15F6NO/c1-9-2-3-11(4-9)14(24)23-8-10-5-12(15(17,18)19)7-13(6-10)16(20,21)22/h5-7,11H,1-4,8H2,(H,23,24) |
| InChIKey | AMKNXQRDXGRYAT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|