C28H37F2NO — CID 143083272
1-[[1-(3-tert-butyl-5-methylphenyl)-3-methylidenecyclohexyl]amino]-4-(3,5-difluorophenyl)butan-2-ol (PubChem CID 143083272) has the molecular formula C28H37F2NO and a molecular weight of 441.61 g/mol. Its IUPAC name is 1-[[1-(3-tert-butyl-5-methylphenyl)-3-methylidenecyclohexyl]amino]-4-(3,5-difluorophenyl)butan-2-ol.
| Compound Name | 1-[[1-(3-tert-butyl-5-methylphenyl)-3-methylidenecyclohexyl]amino]-4-(3,5-difluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 143083272 |
| Molecular Formula | C28H37F2NO |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | 1-[[1-(3-tert-butyl-5-methylphenyl)-3-methylidenecyclohexyl]amino]-4-(3,5-difluorophenyl)butan-2-ol |
| SMILES | C=C1CCCC(NCC(O)CCc2cc(F)cc(F)c2)(c2cc(C)cc(C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C28H37F2NO/c1-19-7-6-10-28(17-19,23-12-20(2)11-22(15-23)27(3,4)5)31-18-26(32)9-8-21-13-24(29)16-25(30)14-21/h11-16,26,31-32H,1,6-10,17-18H2,2-5H3 |
| InChIKey | BJYIYFGVPOOPKT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|