C28H39F2N3O3 — CID 87451120
dimethylamino 3-(3-tert-butylphenyl)-3-[[4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]piperidine-1-carboxylate (PubChem CID 87451120) has the molecular formula C28H39F2N3O3 and a molecular weight of 503.63 g/mol. Its IUPAC name is dimethylamino 3-(3-tert-butylphenyl)-3-[[4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]piperidine-1-carboxylate.
| Compound Name | dimethylamino 3-(3-tert-butylphenyl)-3-[[4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87451120 |
| Molecular Formula | C28H39F2N3O3 |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | dimethylamino 3-(3-tert-butylphenyl)-3-[[4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]piperidine-1-carboxylate |
| SMILES | CN(C)OC(=O)N1CCCC(NCC(O)CCc2cc(F)cc(F)c2)(c2cccc(C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C28H39F2N3O3/c1-27(2,3)21-8-6-9-22(16-21)28(12-7-13-33(19-28)26(35)36-32(4)5)31-18-25(34)11-10-20-14-23(29)17-24(30)15-20/h6,8-9,14-17,25,31,34H,7,10-13,18-19H2,1-5H3 |
| InChIKey | DZWPTWVAOWXXSZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|