C40H58F2N2O6 — CID 11308535
ditert-butyl 2-[[4-[[1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]carbamoyl]pentanedioate (PubChem CID 11308535) has the molecular formula C40H58F2N2O6 and a molecular weight of 700.91 g/mol. Its IUPAC name is ditert-butyl 2-[[4-[[1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]carbamoyl]pentanedioate.
| Compound Name | ditert-butyl 2-[[4-[[1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]carbamoyl]pentanedioate |
|---|---|
| PubChem CID | 11308535 |
| Molecular Formula | C40H58F2N2O6 |
| Molecular Weight | 700.91 g/mol |
| Exact Mass | 700.43 |
| IUPAC Name | ditert-butyl 2-[[4-[[1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]carbamoyl]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(C(=O)NC(Cc1cc(F)cc(F)c1)C(O)CNC1(c2cccc(C(C)(C)C)c2)CCCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H58F2N2O6/c1-37(2,3)27-14-13-15-28(23-27)40(18-11-10-12-19-40)43-25-33(45)32(22-26-20-29(41)24-30(42)21-26)44-35(47)31(36(48)50-39(7,8)9)16-17-34(46)49-38(4,5)6/h13-15,20-21,23-24,31-33,43,45H,10-12,16-19,22,25H2,1-9H3,(H,44,47) |
| InChIKey | LMVNTNBQKXZPBP-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.91 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|