C27H36F2N2O2 — CID 11590669
1-[[1-(3-tert-butylphenyl)-4-hydroxyiminocyclohexyl]amino]-4-(3,5-difluorophenyl)pentan-2-ol (PubChem CID 11590669) has the molecular formula C27H36F2N2O2 and a molecular weight of 458.59 g/mol. Its IUPAC name is 1-[[1-(3-tert-butylphenyl)-4-hydroxyiminocyclohexyl]amino]-4-(3,5-difluorophenyl)pentan-2-ol.
| Compound Name | 1-[[1-(3-tert-butylphenyl)-4-hydroxyiminocyclohexyl]amino]-4-(3,5-difluorophenyl)pentan-2-ol |
|---|---|
| PubChem CID | 11590669 |
| Molecular Formula | C27H36F2N2O2 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 1-[[1-(3-tert-butylphenyl)-4-hydroxyiminocyclohexyl]amino]-4-(3,5-difluorophenyl)pentan-2-ol |
| SMILES | CC(CC(O)CNC1(c2cccc(C(C)(C)C)c2)CCC(=NO)CC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C27H36F2N2O2/c1-18(19-13-22(28)16-23(29)14-19)12-25(32)17-30-27(10-8-24(31-33)9-11-27)21-7-5-6-20(15-21)26(2,3)4/h5-7,13-16,18,25,30,32-33H,8-12,17H2,1-4H3/b31-24- |
| InChIKey | UBAQFORLRKAXND-QLTSDVKISA-N |
| XLogP | 6.01 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|