C27H36F2N2 — CID 91176110
1-N-[1-(3-tert-butylphenyl)-4-methylidenecyclohexyl]-4-(3,5-difluorophenyl)butane-1,3-diamine (PubChem CID 91176110) has the molecular formula C27H36F2N2 and a molecular weight of 426.60 g/mol. Its IUPAC name is 1-N-[1-(3-tert-butylphenyl)-4-methylidenecyclohexyl]-4-(3,5-difluorophenyl)butane-1,3-diamine.
| Compound Name | 1-N-[1-(3-tert-butylphenyl)-4-methylidenecyclohexyl]-4-(3,5-difluorophenyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 91176110 |
| Molecular Formula | C27H36F2N2 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 1-N-[1-(3-tert-butylphenyl)-4-methylidenecyclohexyl]-4-(3,5-difluorophenyl)butane-1,3-diamine |
| SMILES | C=C1CCC(NCCC(N)Cc2cc(F)cc(F)c2)(c2cccc(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C27H36F2N2/c1-19-8-11-27(12-9-19,22-7-5-6-21(17-22)26(2,3)4)31-13-10-25(30)16-20-14-23(28)18-24(29)15-20/h5-7,14-15,17-18,25,31H,1,8-13,16,30H2,2-4H3 |
| InChIKey | CVBDLIUDKMGJRO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|