C29H41F2N5O — CID 143107527
N'-[4-[[1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-N-(2-methylidenehydrazinyl)ethanimidamide (PubChem CID 143107527) has the molecular formula C29H41F2N5O and a molecular weight of 513.68 g/mol. Its IUPAC name is N'-[4-[[1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-N-(2-methylidenehydrazinyl)ethanimidamide.
| Compound Name | N'-[4-[[1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-N-(2-methylidenehydrazinyl)ethanimidamide |
|---|---|
| PubChem CID | 143107527 |
| Molecular Formula | C29H41F2N5O |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.33 |
| IUPAC Name | N'-[4-[[1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-N-(2-methylidenehydrazinyl)ethanimidamide |
| SMILES | C=NNN/C(C)=N/C(Cc1cc(F)cc(F)c1)C(O)CNC1(c2cccc(C(C)(C)C)c2)CCCCC1 |
| InChI | InChI=1S/C29H41F2N5O/c1-20(35-36-32-5)34-26(16-21-14-24(30)18-25(31)15-21)27(37)19-33-29(12-7-6-8-13-29)23-11-9-10-22(17-23)28(2,3)4/h9-11,14-15,17-18,26-27,33,36-37H,5-8,12-13,16,19H2,1-4H3,(H,34,35) |
| InChIKey | JECGUOIGZDKQKB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|