C30H41F2N3O2 — CID 143171447
N-[(2S)-4-[[1-(3-tert-butylphenyl)-4-ethoxyiminocyclohexyl]amino]-1-(3,5-difluorophenyl)butan-2-yl]acetamide (PubChem CID 143171447) has the molecular formula C30H41F2N3O2 and a molecular weight of 513.67 g/mol. Its IUPAC name is N-[(2S)-4-[[1-(3-tert-butylphenyl)-4-ethoxyiminocyclohexyl]amino]-1-(3,5-difluorophenyl)butan-2-yl]acetamide.
| Compound Name | N-[(2S)-4-[[1-(3-tert-butylphenyl)-4-ethoxyiminocyclohexyl]amino]-1-(3,5-difluorophenyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 143171447 |
| Molecular Formula | C30H41F2N3O2 |
| Molecular Weight | 513.67 g/mol |
| Exact Mass | 513.32 |
| IUPAC Name | N-[(2S)-4-[[1-(3-tert-butylphenyl)-4-ethoxyiminocyclohexyl]amino]-1-(3,5-difluorophenyl)butan-2-yl]acetamide |
| SMILES | CCON=C1CCC(NCC[C@H](Cc2cc(F)cc(F)c2)NC(C)=O)(c2cccc(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C30H41F2N3O2/c1-6-37-35-27-10-13-30(14-11-27,24-9-7-8-23(19-24)29(3,4)5)33-15-12-28(34-21(2)36)18-22-16-25(31)20-26(32)17-22/h7-9,16-17,19-20,28,33H,6,10-15,18H2,1-5H3,(H,34,36)/b35-27-/t28-,30?/m1/s1 |
| InChIKey | CZHQXIHGKLALCG-JFXOFINOSA-N |
| XLogP | 6.15 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.67 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|