C29H33F2N3O3S — CID 11512223
N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[4-methoxyimino-1-(3-thiophen-3-ylphenyl)cyclohexyl]amino]butan-2-yl]acetamide (PubChem CID 11512223) has the molecular formula C29H33F2N3O3S and a molecular weight of 541.66 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[4-methoxyimino-1-(3-thiophen-3-ylphenyl)cyclohexyl]amino]butan-2-yl]acetamide.
| Compound Name | N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[4-methoxyimino-1-(3-thiophen-3-ylphenyl)cyclohexyl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 11512223 |
| Molecular Formula | C29H33F2N3O3S |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[4-methoxyimino-1-(3-thiophen-3-ylphenyl)cyclohexyl]amino]butan-2-yl]acetamide |
| SMILES | CON=C1CCC(NCC(O)C(Cc2cc(F)cc(F)c2)NC(C)=O)(c2cccc(-c3ccsc3)c2)CC1 |
| InChI | InChI=1S/C29H33F2N3O3S/c1-19(35)33-27(14-20-12-24(30)16-25(31)13-20)28(36)17-32-29(9-6-26(7-10-29)34-37-2)23-5-3-4-21(15-23)22-8-11-38-18-22/h3-5,8,11-13,15-16,18,27-28,32,36H,6-7,9-10,14,17H2,1-2H3,(H,33,35)/b34-26- |
| InChIKey | NCFQDASILMKTTN-CLIDGEQKSA-N |
| XLogP | 5.16 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|