C21H27BrFNOS — CID 143083162
(2S)-1-[[1-(5-bromothiophen-2-yl)cyclohexyl]amino]-4-(3-fluoro-5-methylphenyl)butan-2-ol (PubChem CID 143083162) has the molecular formula C21H27BrFNOS and a molecular weight of 440.42 g/mol. Its IUPAC name is (2S)-1-[[1-(5-bromothiophen-2-yl)cyclohexyl]amino]-4-(3-fluoro-5-methylphenyl)butan-2-ol.
| Compound Name | (2S)-1-[[1-(5-bromothiophen-2-yl)cyclohexyl]amino]-4-(3-fluoro-5-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 143083162 |
| Molecular Formula | C21H27BrFNOS |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (2S)-1-[[1-(5-bromothiophen-2-yl)cyclohexyl]amino]-4-(3-fluoro-5-methylphenyl)butan-2-ol |
| SMILES | Cc1cc(F)cc(CC[C@H](O)CNC2(c3ccc(Br)s3)CCCCC2)c1 |
| InChI | InChI=1S/C21H27BrFNOS/c1-15-11-16(13-17(23)12-15)5-6-18(25)14-24-21(9-3-2-4-10-21)19-7-8-20(22)26-19/h7-8,11-13,18,24-25H,2-6,9-10,14H2,1H3/t18-/m0/s1 |
| InChIKey | UMLHFIHNFIRIQW-SFHVURJKSA-N |
| XLogP | 5.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |