C25H33F2NOSSi — CID 70332635
(2S)-4-(3,5-difluorophenyl)-1-[[1-[5-(2-trimethylsilylethynyl)thiophen-2-yl]cyclohexyl]amino]butan-2-ol (PubChem CID 70332635) has the molecular formula C25H33F2NOSSi and a molecular weight of 461.69 g/mol. Its IUPAC name is (2S)-4-(3,5-difluorophenyl)-1-[[1-[5-(2-trimethylsilylethynyl)thiophen-2-yl]cyclohexyl]amino]butan-2-ol.
| Compound Name | (2S)-4-(3,5-difluorophenyl)-1-[[1-[5-(2-trimethylsilylethynyl)thiophen-2-yl]cyclohexyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 70332635 |
| Molecular Formula | C25H33F2NOSSi |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (2S)-4-(3,5-difluorophenyl)-1-[[1-[5-(2-trimethylsilylethynyl)thiophen-2-yl]cyclohexyl]amino]butan-2-ol |
| SMILES | C[Si](C)(C)C#Cc1ccc(C2(NC[C@@H](O)CCc3cc(F)cc(F)c3)CCCCC2)s1 |
| InChI | InChI=1S/C25H33F2NOSSi/c1-31(2,3)14-11-23-9-10-24(30-23)25(12-5-4-6-13-25)28-18-22(29)8-7-19-15-20(26)17-21(27)16-19/h9-10,15-17,22,28-29H,4-8,12-13,18H2,1-3H3/t22-/m0/s1 |
| InChIKey | KRAOJCHLWIXJCI-QFIPXVFZSA-N |
| XLogP | 6.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|