C25H23Cl2N3O4 — CID 143083452
methanol;methyl 4-[2-(2-amino-5-chlorophenyl)prop-2-enyl]-3-(5-chloro-1H-indol-3-yl)-5-formyl-1H-pyrrole-2-carboxylate (PubChem CID 143083452) has the molecular formula C25H23Cl2N3O4 and a molecular weight of 500.38 g/mol. Its IUPAC name is methanol;methyl 4-[2-(2-amino-5-chlorophenyl)prop-2-enyl]-3-(5-chloro-1H-indol-3-yl)-5-formyl-1H-pyrrole-2-carboxylate.
| Compound Name | methanol;methyl 4-[2-(2-amino-5-chlorophenyl)prop-2-enyl]-3-(5-chloro-1H-indol-3-yl)-5-formyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 143083452 |
| Molecular Formula | C25H23Cl2N3O4 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | methanol;methyl 4-[2-(2-amino-5-chlorophenyl)prop-2-enyl]-3-(5-chloro-1H-indol-3-yl)-5-formyl-1H-pyrrole-2-carboxylate |
| SMILES | C=C(Cc1c(C=O)[nH]c(C(=O)OC)c1-c1c[nH]c2ccc(Cl)cc12)c1cc(Cl)ccc1N.CO |
| InChI | InChI=1S/C24H19Cl2N3O3.CH4O/c1-12(15-8-13(25)3-5-19(15)27)7-17-21(11-30)29-23(24(31)32-2)22(17)18-10-28-20-6-4-14(26)9-16(18)20;1-2/h3-6,8-11,28-29H,1,7,27H2,2H3;2H,1H3 |
| InChIKey | JZXDOOUTSQTAHI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|