C27H25N3O4S — CID 143083798
(Z)-N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-2-yl]-3-(methylideneamino)-2-methylsulfanylbut-2-enamide (PubChem CID 143083798) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is (Z)-N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-2-yl]-3-(methylideneamino)-2-methylsulfanylbut-2-enamide.
| Compound Name | (Z)-N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-2-yl]-3-(methylideneamino)-2-methylsulfanylbut-2-enamide |
|---|---|
| PubChem CID | 143083798 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (Z)-N-[6-(6,7-dimethoxyquinolin-4-yl)oxynaphthalen-2-yl]-3-(methylideneamino)-2-methylsulfanylbut-2-enamide |
| SMILES | C=N/C(C)=C(\SC)C(=O)Nc1ccc2cc(Oc3ccnc4cc(OC)c(OC)cc34)ccc2c1 |
| InChI | InChI=1S/C27H25N3O4S/c1-16(28-2)26(35-5)27(31)30-19-8-6-18-13-20(9-7-17(18)12-19)34-23-10-11-29-22-15-25(33-4)24(32-3)14-21(22)23/h6-15H,2H2,1,3-5H3,(H,30,31)/b26-16- |
| InChIKey | IHLQHMDVFIJDBI-QQXSKIMKSA-N |
| XLogP | 6.43 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|