C17H14F2N2O4 — CID 143084408
3-(3,4-difluorophenyl)-6-methoxy-1-benzofuran-2-carboxamide;formamide (PubChem CID 143084408) has the molecular formula C17H14F2N2O4 and a molecular weight of 348.31 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-6-methoxy-1-benzofuran-2-carboxamide;formamide.
| Compound Name | 3-(3,4-difluorophenyl)-6-methoxy-1-benzofuran-2-carboxamide;formamide |
|---|---|
| PubChem CID | 143084408 |
| Molecular Formula | C17H14F2N2O4 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-(3,4-difluorophenyl)-6-methoxy-1-benzofuran-2-carboxamide;formamide |
| SMILES | COc1ccc2c(-c3ccc(F)c(F)c3)c(C(N)=O)oc2c1.NC=O |
| InChI | InChI=1S/C16H11F2NO3.CH3NO/c1-21-9-3-4-10-13(7-9)22-15(16(19)20)14(10)8-2-5-11(17)12(18)6-8;2-1-3/h2-7H,1H3,(H2,19,20);1H,(H2,2,3) |
| InChIKey | BIIPHIRPOAAFPY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|