C31H27N3OS — CID 143085209
(10Z,12Z)-14-amino-9-methylidene-N-[4-(4-methylnaphthalen-1-yl)-1,3-thiazol-2-yl]tricyclo[6.5.2.02,7]pentadeca-2,4,6,10,12-pentaene-14-carboxamide (PubChem CID 143085209) has the molecular formula C31H27N3OS and a molecular weight of 489.64 g/mol. Its IUPAC name is (10Z,12Z)-14-amino-9-methylidene-N-[4-(4-methylnaphthalen-1-yl)-1,3-thiazol-2-yl]tricyclo[6.5.2.02,7]pentadeca-2,4,6,10,12-pentaene-14-carboxamide.
| Compound Name | (10Z,12Z)-14-amino-9-methylidene-N-[4-(4-methylnaphthalen-1-yl)-1,3-thiazol-2-yl]tricyclo[6.5.2.02,7]pentadeca-2,4,6,10,12-pentaene-14-carboxamide |
|---|---|
| PubChem CID | 143085209 |
| Molecular Formula | C31H27N3OS |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (10Z,12Z)-14-amino-9-methylidene-N-[4-(4-methylnaphthalen-1-yl)-1,3-thiazol-2-yl]tricyclo[6.5.2.02,7]pentadeca-2,4,6,10,12-pentaene-14-carboxamide |
| SMILES | C=C1/C=C\C=C/C2c3ccccc3C1CC2(N)C(=O)Nc1nc(-c2ccc(C)c3ccccc23)cs1 |
| InChI | InChI=1S/C31H27N3OS/c1-19-9-3-8-14-27-24-13-7-6-12-23(24)26(19)17-31(27,32)29(35)34-30-33-28(18-36-30)25-16-15-20(2)21-10-4-5-11-22(21)25/h3-16,18,26-27H,1,17,32H2,2H3,(H,33,34,35)/b9-3-,14-8- |
| InChIKey | PJKPKYOAZYUGLU-PKJORLPLSA-N |
| XLogP | 6.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |