C32H29N2O4P — CID 143085381
N-benzylformamide;N-[3-(methoxymethyl)naphthalen-2-yl]-2-naphthalen-1-yl-2-phosphorosoacetamide (PubChem CID 143085381) has the molecular formula C32H29N2O4P and a molecular weight of 536.57 g/mol. Its IUPAC name is N-benzylformamide;N-[3-(methoxymethyl)naphthalen-2-yl]-2-naphthalen-1-yl-2-phosphorosoacetamide.
| Compound Name | N-benzylformamide;N-[3-(methoxymethyl)naphthalen-2-yl]-2-naphthalen-1-yl-2-phosphorosoacetamide |
|---|---|
| PubChem CID | 143085381 |
| Molecular Formula | C32H29N2O4P |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | N-benzylformamide;N-[3-(methoxymethyl)naphthalen-2-yl]-2-naphthalen-1-yl-2-phosphorosoacetamide |
| SMILES | COCc1cc2ccccc2cc1NC(=O)C(P=O)c1cccc2ccccc12.O=CNCc1ccccc1 |
| InChI | InChI=1S/C24H20NO3P.C8H9NO/c1-28-15-19-13-17-8-2-3-9-18(17)14-22(19)25-24(26)23(29-27)21-12-6-10-16-7-4-5-11-20(16)21;10-7-9-6-8-4-2-1-3-5-8/h2-14,23H,15H2,1H3,(H,25,26);1-5,7H,6H2,(H,9,10) |
| InChIKey | IMOANJAISNZLJE-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|