C10H10F3N2O2- — CID 143086086
N-[[2-(oxidoamino)-4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 143086086) has the molecular formula C10H10F3N2O2- and a molecular weight of 247.20 g/mol. Its IUPAC name is N-[[2-(oxidoamino)-4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | N-[[2-(oxidoamino)-4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 143086086 |
| Molecular Formula | C10H10F3N2O2- |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-[[2-(oxidoamino)-4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(F)(F)F)cc1N[O-] |
| InChI | InChI=1S/C10H10F3N2O2/c1-6(16)14-5-7-2-3-8(10(11,12)13)4-9(7)15-17/h2-4,15H,5H2,1H3,(H,14,16)/q-1 |
| InChIKey | AMRBZPCHQWPVIJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|