C18H23FINOS — CID 143086151
2-(3,3-dimethylbutyl)-4-fluoro-N-[(2-iodothiophen-3-yl)-methoxymethyl]aniline (PubChem CID 143086151) has the molecular formula C18H23FINOS and a molecular weight of 447.36 g/mol. Its IUPAC name is 2-(3,3-dimethylbutyl)-4-fluoro-N-[(2-iodothiophen-3-yl)-methoxymethyl]aniline.
| Compound Name | 2-(3,3-dimethylbutyl)-4-fluoro-N-[(2-iodothiophen-3-yl)-methoxymethyl]aniline |
|---|---|
| PubChem CID | 143086151 |
| Molecular Formula | C18H23FINOS |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 2-(3,3-dimethylbutyl)-4-fluoro-N-[(2-iodothiophen-3-yl)-methoxymethyl]aniline |
| SMILES | COC(Nc1ccc(F)cc1CCC(C)(C)C)c1ccsc1I |
| InChI | InChI=1S/C18H23FINOS/c1-18(2,3)9-7-12-11-13(19)5-6-15(12)21-17(22-4)14-8-10-23-16(14)20/h5-6,8,10-11,17,21H,7,9H2,1-4H3 |
| InChIKey | NFMKODBMOKNLFR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|