benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid

C21H21NO7 — CID 143086252

IUPACbenzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid
SMILESCOc1ccc2c(CCC(=O)O)cc(=O)oc2c1.NC(=O)OCc1ccccc1
InChIInChI=1S/C13H12O5.C8H9NO2/c1-17-9-3-4-10-8(2-5-12(14)15)6-13(16)18-11(10)7-9;9-8(10)11-6-7-4-2-1-3-5-7/h3-4,6-7H,2,5H2,1H3,(H,14,15);1-5H,6H2,(H2,9,10)
InChIKeyURQIBNRFYDMMHX-UHFFFAOYSA-N
MW399.40 g/mol
LogP3.10
Rot. Bonds6

About benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid

benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid (PubChem CID 143086252) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid.

Molecular Properties

Compound Namebenzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid
PubChem CID143086252
Molecular FormulaC21H21NO7
Molecular Weight399.40 g/mol
Exact Mass399.13
IUPAC Namebenzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid
SMILESCOc1ccc2c(CCC(=O)O)cc(=O)oc2c1.NC(=O)OCc1ccccc1
InChIInChI=1S/C13H12O5.C8H9NO2/c1-17-9-3-4-10-8(2-5-12(14)15)6-13(16)18-11(10)7-9;9-8(10)11-6-7-4-2-1-3-5-7/h3-4,6-7H,2,5H2,1H3,(H,14,15);1-5H,6H2,(H2,9,10)
InChIKeyURQIBNRFYDMMHX-UHFFFAOYSA-N
XLogP3.10
TPSA129.06 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500399.40
LogP ≤ 53.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cumarine', 'substructure': 'N/A'}

Analyze benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid?
The IUPAC name of benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid (CID 143086252) is benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid.
What is the SMILES notation for benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid?
The canonical SMILES for benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid is COc1ccc2c(CCC(=O)O)cc(=O)oc2c1.NC(=O)OCc1ccccc1.
What is the InChIKey of benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid?
The InChIKey is URQIBNRFYDMMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O5.C8H9NO2/c1-17-9-3-4-10-8(2-5-12(14)15)6-13(16)18-11(10)7-9;9-8(10)11-6-7-4-2-1-3-5-7/h3-4,6-7H,2,5H2,1H3,(H,14,15);1-5H,6H2,(H2,9,10).
What are the key properties of benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid?
benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid has a molecular weight of 399.40 g/mol, XLogP of 3.10, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid is sourced from PubChem (CID 143086252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).