C21H21NO7 — CID 143086252
benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid (PubChem CID 143086252) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid.
| Compound Name | benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid |
|---|---|
| PubChem CID | 143086252 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | benzyl carbamate;3-(7-methoxy-2-oxochromen-4-yl)propanoic acid |
| SMILES | COc1ccc2c(CCC(=O)O)cc(=O)oc2c1.NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H12O5.C8H9NO2/c1-17-9-3-4-10-8(2-5-12(14)15)6-13(16)18-11(10)7-9;9-8(10)11-6-7-4-2-1-3-5-7/h3-4,6-7H,2,5H2,1H3,(H,14,15);1-5H,6H2,(H2,9,10) |
| InChIKey | URQIBNRFYDMMHX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|