C13H20O2S2 — CID 143086471
2-[(E)-3-cyclohexa-1,5-dien-1-yl-1-(2-hydroxyethylsulfanyl)prop-2-enyl]sulfanylethanol (PubChem CID 143086471) has the molecular formula C13H20O2S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-[(E)-3-cyclohexa-1,5-dien-1-yl-1-(2-hydroxyethylsulfanyl)prop-2-enyl]sulfanylethanol.
| Compound Name | 2-[(E)-3-cyclohexa-1,5-dien-1-yl-1-(2-hydroxyethylsulfanyl)prop-2-enyl]sulfanylethanol |
|---|---|
| PubChem CID | 143086471 |
| Molecular Formula | C13H20O2S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[(E)-3-cyclohexa-1,5-dien-1-yl-1-(2-hydroxyethylsulfanyl)prop-2-enyl]sulfanylethanol |
| SMILES | OCCSC(/C=C/C1=CCCC=C1)SCCO |
| InChI | InChI=1S/C13H20O2S2/c14-8-10-16-13(17-11-9-15)7-6-12-4-2-1-3-5-12/h2,4-7,13-15H,1,3,8-11H2/b7-6+ |
| InChIKey | DUGREFYEXQRMTD-VOTSOKGWSA-N |
| XLogP | 2.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|