C15H20OS2 — CID 163623475
2,3-bis(cyclohexa-2,4-dien-1-ylsulfanyl)propan-1-ol (PubChem CID 163623475) has the molecular formula C15H20OS2 and a molecular weight of 280.46 g/mol. Its IUPAC name is 2,3-bis(cyclohexa-2,4-dien-1-ylsulfanyl)propan-1-ol.
| Compound Name | 2,3-bis(cyclohexa-2,4-dien-1-ylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 163623475 |
| Molecular Formula | C15H20OS2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2,3-bis(cyclohexa-2,4-dien-1-ylsulfanyl)propan-1-ol |
| SMILES | OCC(CSC1C=CC=CC1)SC1C=CC=CC1 |
| InChI | InChI=1S/C15H20OS2/c16-11-15(18-14-9-5-2-6-10-14)12-17-13-7-3-1-4-8-13/h1-7,9,13-16H,8,10-12H2 |
| InChIKey | HQCRRHKOZLZUCI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |