C14H23N5O — CID 143087720
4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]cyclohexan-1-one;ethane (PubChem CID 143087720) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]cyclohexan-1-one;ethane.
| Compound Name | 4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]cyclohexan-1-one;ethane |
|---|---|
| PubChem CID | 143087720 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 4-[(6-amino-5-ethanimidoylpyrimidin-4-yl)amino]cyclohexan-1-one;ethane |
| SMILES | CC.[H]/N=C(\C)c1c(N)ncnc1NC1CCC(=O)CC1 |
| InChI | InChI=1S/C12H17N5O.C2H6/c1-7(13)10-11(14)15-6-16-12(10)17-8-2-4-9(18)5-3-8;1-2/h6,8,13H,2-5H2,1H3,(H3,14,15,16,17);1-2H3/b13-7+; |
| InChIKey | ONKRXXSPOAXVCB-FTPOTTDRSA-N |
| XLogP | 2.40 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|