C14H25N5 — CID 143087794
4-N-cyclohexyl-5-ethanimidoylpyrimidine-4,6-diamine;ethane (PubChem CID 143087794) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 4-N-cyclohexyl-5-ethanimidoylpyrimidine-4,6-diamine;ethane.
| Compound Name | 4-N-cyclohexyl-5-ethanimidoylpyrimidine-4,6-diamine;ethane |
|---|---|
| PubChem CID | 143087794 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 4-N-cyclohexyl-5-ethanimidoylpyrimidine-4,6-diamine;ethane |
| SMILES | CC.[H]/N=C(\C)c1c(N)ncnc1NC1CCCCC1 |
| InChI | InChI=1S/C12H19N5.C2H6/c1-8(13)10-11(14)15-7-16-12(10)17-9-5-3-2-4-6-9;1-2/h7,9,13H,2-6H2,1H3,(H3,14,15,16,17);1-2H3/b13-8+; |
| InChIKey | XDOMJAHBKNCKGT-FNXZNAJJSA-N |
| XLogP | 3.22 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|