C23H32N4O2S — CID 143089125
2-(ethoxymethyl)-1-[[1-(2-methylsulfanylethoxy)cyclohexyl]methyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 143089125) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1-[[1-(2-methylsulfanylethoxy)cyclohexyl]methyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-(ethoxymethyl)-1-[[1-(2-methylsulfanylethoxy)cyclohexyl]methyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 143089125 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-(ethoxymethyl)-1-[[1-(2-methylsulfanylethoxy)cyclohexyl]methyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1CC1(OCCSC)CCCCC1 |
| InChI | InChI=1S/C23H32N4O2S/c1-3-28-15-19-26-20-21(17-9-5-6-10-18(17)25-22(20)24)27(19)16-23(29-13-14-30-2)11-7-4-8-12-23/h5-6,9-10H,3-4,7-8,11-16H2,1-2H3,(H2,24,25) |
| InChIKey | XBRQQEFZIFSMBY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|