C12H23NO2 — CID 143089401
ethane;1-(6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrano[2,3-c]pyrrol-5-yl)ethanone (PubChem CID 143089401) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is ethane;1-(6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrano[2,3-c]pyrrol-5-yl)ethanone.
| Compound Name | ethane;1-(6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrano[2,3-c]pyrrol-5-yl)ethanone |
|---|---|
| PubChem CID | 143089401 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | ethane;1-(6-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrano[2,3-c]pyrrol-5-yl)ethanone |
| SMILES | CC.CC(=O)C1C2CCCOC2CN1C |
| InChI | InChI=1S/C10H17NO2.C2H6/c1-7(12)10-8-4-3-5-13-9(8)6-11(10)2;1-2/h8-10H,3-6H2,1-2H3;1-2H3 |
| InChIKey | BILJCHVZTPVBQN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |