C23H28BrN5O — CID 143089979
(2Z,4E,7Z)-8-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-5-ethenyl-8-[[3-(methylamino)cyclohepta-2,4,6-trien-1-yl]methylamino]octa-2,4,7-trien-4-ol (PubChem CID 143089979) has the molecular formula C23H28BrN5O and a molecular weight of 470.42 g/mol. Its IUPAC name is (2Z,4E,7Z)-8-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-5-ethenyl-8-[[3-(methylamino)cyclohepta-2,4,6-trien-1-yl]methylamino]octa-2,4,7-trien-4-ol.
| Compound Name | (2Z,4E,7Z)-8-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-5-ethenyl-8-[[3-(methylamino)cyclohepta-2,4,6-trien-1-yl]methylamino]octa-2,4,7-trien-4-ol |
|---|---|
| PubChem CID | 143089979 |
| Molecular Formula | C23H28BrN5O |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (2Z,4E,7Z)-8-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-5-ethenyl-8-[[3-(methylamino)cyclohepta-2,4,6-trien-1-yl]methylamino]octa-2,4,7-trien-4-ol |
| SMILES | C=C/C(C/C=C(/NCC1C=CC=CC(NC)=C1)n1ncc(Br)c1N=C)=C(O)\C=C/C |
| InChI | InChI=1S/C23H28BrN5O/c1-5-9-21(30)18(6-2)12-13-22(29-23(26-4)20(24)16-28-29)27-15-17-10-7-8-11-19(14-17)25-3/h5-11,13-14,16-17,25,27,30H,2,4,12,15H2,1,3H3/b9-5-,21-18-,22-13- |
| InChIKey | RMPLCIGXJKVGNX-IHLJBCDBSA-N |
| XLogP | 5.18 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|