C20H32BrN5O — CID 143090799
(1Z,4Z,6Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-2,4-dimethyl-1-[4-(methylamino)butylamino]nona-1,4,6-trien-5-ol (PubChem CID 143090799) has the molecular formula C20H32BrN5O and a molecular weight of 438.41 g/mol. Its IUPAC name is (1Z,4Z,6Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-2,4-dimethyl-1-[4-(methylamino)butylamino]nona-1,4,6-trien-5-ol.
| Compound Name | (1Z,4Z,6Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-2,4-dimethyl-1-[4-(methylamino)butylamino]nona-1,4,6-trien-5-ol |
|---|---|
| PubChem CID | 143090799 |
| Molecular Formula | C20H32BrN5O |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (1Z,4Z,6Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-2,4-dimethyl-1-[4-(methylamino)butylamino]nona-1,4,6-trien-5-ol |
| SMILES | C=Nc1c(Br)cnn1/C(NCCCCNC)=C(/C)C/C(C)=C(O)/C=C\CC |
| InChI | InChI=1S/C20H32BrN5O/c1-6-7-10-18(27)15(2)13-16(3)19(24-12-9-8-11-22-4)26-20(23-5)17(21)14-25-26/h7,10,14,22,24,27H,5-6,8-9,11-13H2,1-4H3/b10-7-,18-15-,19-16- |
| InChIKey | UGTQJRDYZWMCOQ-CLMIKFBESA-N |
| XLogP | 4.94 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|