C34H46BrN5 — CID 143441839
N'-[1-[4-bromo-5-[(E)-1-(2-methylcyclohepta-1,3,6-trien-1-yl)ethylideneamino]pyrazol-1-yl]ethyl]-N-methylbutane-1,4-diamine;6-[(2Z)-2-ethenylpenta-2,4-dienylidene]cyclohepta-1,3-diene (PubChem CID 143441839) has the molecular formula C34H46BrN5 and a molecular weight of 604.68 g/mol. Its IUPAC name is N'-[1-[4-bromo-5-[(E)-1-(2-methylcyclohepta-1,3,6-trien-1-yl)ethylideneamino]pyrazol-1-yl]ethyl]-N-methylbutane-1,4-diamine;6-[(2Z)-2-ethenylpenta-2,4-dienylidene]cyclohepta-1,3-diene.
| Compound Name | N'-[1-[4-bromo-5-[(E)-1-(2-methylcyclohepta-1,3,6-trien-1-yl)ethylideneamino]pyrazol-1-yl]ethyl]-N-methylbutane-1,4-diamine;6-[(2Z)-2-ethenylpenta-2,4-dienylidene]cyclohepta-1,3-diene |
|---|---|
| PubChem CID | 143441839 |
| Molecular Formula | C34H46BrN5 |
| Molecular Weight | 604.68 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | N'-[1-[4-bromo-5-[(E)-1-(2-methylcyclohepta-1,3,6-trien-1-yl)ethylideneamino]pyrazol-1-yl]ethyl]-N-methylbutane-1,4-diamine;6-[(2Z)-2-ethenylpenta-2,4-dienylidene]cyclohepta-1,3-diene |
| SMILES | C=C/C=C(/C=C)C=C1CC=CC=CC1.CNCCCCNC(C)n1ncc(Br)c1/N=C(\C)C1=C(C)C=CCC=C1 |
| InChI | InChI=1S/C20H30BrN5.C14H16/c1-15-10-6-5-7-11-18(15)16(2)25-20-19(21)14-24-26(20)17(3)23-13-9-8-12-22-4;1-3-9-13(4-2)12-14-10-7-5-6-8-11-14/h6-7,10-11,14,17,22-23H,5,8-9,12-13H2,1-4H3;3-9,12H,1-2,10-11H2/b25-16+;13-9- |
| InChIKey | XQYWEUIWMPUSLU-SFASZXLQSA-N |
| XLogP | 8.80 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.68 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|