C22H33BrN4 — CID 143089990
N'-[(5E,7Z)-1-(4-bromo-5-methylpyrazol-1-yl)-5-ethenyl-6-methyl-4-methylidenenona-2,5,7-trienyl]-N-methylbutane-1,4-diamine (PubChem CID 143089990) has the molecular formula C22H33BrN4 and a molecular weight of 433.44 g/mol. Its IUPAC name is N'-[(5E,7Z)-1-(4-bromo-5-methylpyrazol-1-yl)-5-ethenyl-6-methyl-4-methylidenenona-2,5,7-trienyl]-N-methylbutane-1,4-diamine.
| Compound Name | N'-[(5E,7Z)-1-(4-bromo-5-methylpyrazol-1-yl)-5-ethenyl-6-methyl-4-methylidenenona-2,5,7-trienyl]-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 143089990 |
| Molecular Formula | C22H33BrN4 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N'-[(5E,7Z)-1-(4-bromo-5-methylpyrazol-1-yl)-5-ethenyl-6-methyl-4-methylidenenona-2,5,7-trienyl]-N-methylbutane-1,4-diamine |
| SMILES | C=C/C(C(=C)C=CC(NCCCCNC)n1ncc(Br)c1C)=C(C)\C=C/C |
| InChI | InChI=1S/C22H33BrN4/c1-7-11-17(3)20(8-2)18(4)12-13-22(25-15-10-9-14-24-6)27-19(5)21(23)16-26-27/h7-8,11-13,16,22,24-25H,2,4,9-10,14-15H2,1,3,5-6H3/b11-7-,13-12?,20-17+ |
| InChIKey | VCVGSQXKOVHMCA-JZJPIIGHSA-N |
| XLogP | 5.23 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|