C27H45BrClN5 — CID 143090418
(1Z,4Z,6Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-5-chloro-4-methyl-N-[[1-(3-methylbutyl)piperidin-3-yl]methyl]nona-1,4,6-trien-1-amine;ethane (PubChem CID 143090418) has the molecular formula C27H45BrClN5 and a molecular weight of 555.05 g/mol. Its IUPAC name is (1Z,4Z,6Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-5-chloro-4-methyl-N-[[1-(3-methylbutyl)piperidin-3-yl]methyl]nona-1,4,6-trien-1-amine;ethane.
| Compound Name | (1Z,4Z,6Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-5-chloro-4-methyl-N-[[1-(3-methylbutyl)piperidin-3-yl]methyl]nona-1,4,6-trien-1-amine;ethane |
|---|---|
| PubChem CID | 143090418 |
| Molecular Formula | C27H45BrClN5 |
| Molecular Weight | 555.05 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | (1Z,4Z,6Z)-1-[4-bromo-5-(methylideneamino)pyrazol-1-yl]-5-chloro-4-methyl-N-[[1-(3-methylbutyl)piperidin-3-yl]methyl]nona-1,4,6-trien-1-amine;ethane |
| SMILES | C=Nc1c(Br)cnn1/C(=C\C/C(C)=C(Cl)/C=C\CC)NCC1CCCN(CCC(C)C)C1.CC |
| InChI | InChI=1S/C25H39BrClN5.C2H6/c1-6-7-10-23(27)20(4)11-12-24(32-25(28-5)22(26)17-30-32)29-16-21-9-8-14-31(18-21)15-13-19(2)3;1-2/h7,10,12,17,19,21,29H,5-6,8-9,11,13-16,18H2,1-4H3;1-2H3/b10-7-,23-20-,24-12-; |
| InChIKey | VTDXMNQTPKSSDX-SCJLEHMZSA-N |
| XLogP | 8.02 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.05 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|