C20H29BrN4 — CID 143442125
3-bromo-N-(2-methylpentyl)-5-[(2Z,4E)-octa-2,4,7-trien-4-yl]-4,5-dihydropyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 143442125) has the molecular formula C20H29BrN4 and a molecular weight of 405.38 g/mol. Its IUPAC name is 3-bromo-N-(2-methylpentyl)-5-[(2Z,4E)-octa-2,4,7-trien-4-yl]-4,5-dihydropyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-bromo-N-(2-methylpentyl)-5-[(2Z,4E)-octa-2,4,7-trien-4-yl]-4,5-dihydropyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 143442125 |
| Molecular Formula | C20H29BrN4 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-bromo-N-(2-methylpentyl)-5-[(2Z,4E)-octa-2,4,7-trien-4-yl]-4,5-dihydropyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=CC/C=C(\C=C/C)C1C=C(NCC(C)CCC)n2ncc(Br)c2N1 |
| InChI | InChI=1S/C20H29BrN4/c1-5-8-11-16(10-7-3)18-12-19(22-13-15(4)9-6-2)25-20(24-18)17(21)14-23-25/h5,7,10-12,14-15,18,22,24H,1,6,8-9,13H2,2-4H3/b10-7-,16-11+ |
| InChIKey | KZAIPGYHFVISBC-MDKZIDAVSA-N |
| XLogP | 5.34 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|