C17H27BrN4 — CID 143440819
3-bromo-6-[(E)-pent-2-en-2-yl]-N-pentyl-5,6-dihydro-4H-pyrazolo[1,5-a][1,3]diazepin-8-amine (PubChem CID 143440819) has the molecular formula C17H27BrN4 and a molecular weight of 367.34 g/mol. Its IUPAC name is 3-bromo-6-[(E)-pent-2-en-2-yl]-N-pentyl-5,6-dihydro-4H-pyrazolo[1,5-a][1,3]diazepin-8-amine.
| Compound Name | 3-bromo-6-[(E)-pent-2-en-2-yl]-N-pentyl-5,6-dihydro-4H-pyrazolo[1,5-a][1,3]diazepin-8-amine |
|---|---|
| PubChem CID | 143440819 |
| Molecular Formula | C17H27BrN4 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-bromo-6-[(E)-pent-2-en-2-yl]-N-pentyl-5,6-dihydro-4H-pyrazolo[1,5-a][1,3]diazepin-8-amine |
| SMILES | CC/C=C(\C)C1C=C(NCCCCC)n2ncc(Br)c2NC1 |
| InChI | InChI=1S/C17H27BrN4/c1-4-6-7-9-19-16-10-14(13(3)8-5-2)11-20-17-15(18)12-21-22(16)17/h8,10,12,14,19-20H,4-7,9,11H2,1-3H3/b13-8+ |
| InChIKey | XCJRLONCADUWLD-MDWZMJQESA-N |
| XLogP | 4.62 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|