C18H32N4 — CID 168900367
N-hexyl-5-pentan-3-yl-5,8-dihydro-4H-pyrazolo[1,5-a][1,3]diazepin-8-amine (PubChem CID 168900367) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is N-hexyl-5-pentan-3-yl-5,8-dihydro-4H-pyrazolo[1,5-a][1,3]diazepin-8-amine.
| Compound Name | N-hexyl-5-pentan-3-yl-5,8-dihydro-4H-pyrazolo[1,5-a][1,3]diazepin-8-amine |
|---|---|
| PubChem CID | 168900367 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | N-hexyl-5-pentan-3-yl-5,8-dihydro-4H-pyrazolo[1,5-a][1,3]diazepin-8-amine |
| SMILES | CCCCCCNC1C=CC(C(CC)CC)Nc2ccnn21 |
| InChI | InChI=1S/C18H32N4/c1-4-7-8-9-13-19-17-11-10-16(15(5-2)6-3)21-18-12-14-20-22(17)18/h10-12,14-17,19,21H,4-9,13H2,1-3H3 |
| InChIKey | GOOVHRZOQQHMMA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|