C20H30BrN5 — CID 143441840
N'-[1-[4-bromo-5-[(E)-1-(2-methylcyclohepta-1,3,6-trien-1-yl)ethylideneamino]pyrazol-1-yl]ethyl]-N-methylbutane-1,4-diamine (PubChem CID 143441840) has the molecular formula C20H30BrN5 and a molecular weight of 420.40 g/mol. Its IUPAC name is N'-[1-[4-bromo-5-[(E)-1-(2-methylcyclohepta-1,3,6-trien-1-yl)ethylideneamino]pyrazol-1-yl]ethyl]-N-methylbutane-1,4-diamine.
| Compound Name | N'-[1-[4-bromo-5-[(E)-1-(2-methylcyclohepta-1,3,6-trien-1-yl)ethylideneamino]pyrazol-1-yl]ethyl]-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 143441840 |
| Molecular Formula | C20H30BrN5 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N'-[1-[4-bromo-5-[(E)-1-(2-methylcyclohepta-1,3,6-trien-1-yl)ethylideneamino]pyrazol-1-yl]ethyl]-N-methylbutane-1,4-diamine |
| SMILES | CNCCCCNC(C)n1ncc(Br)c1/N=C(\C)C1=C(C)C=CCC=C1 |
| InChI | InChI=1S/C20H30BrN5/c1-15-10-6-5-7-11-18(15)16(2)25-20-19(21)14-24-26(20)17(3)23-13-9-8-12-22-4/h6-7,10-11,14,17,22-23H,5,8-9,12-13H2,1-4H3/b25-16+ |
| InChIKey | VLCIPVJEYCPJSJ-PCLIKHOPSA-N |
| XLogP | 4.68 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|