C24H32N4 — CID 143345771
(3Z,5Z)-5,6-dimethyl-2-methylidene-N-[1-[8-(2-methylprop-2-enyl)-6H-pyrazolo[1,5-a][1,3]diazepin-5-yl]ethenyl]octa-3,5-dien-1-amine (PubChem CID 143345771) has the molecular formula C24H32N4 and a molecular weight of 376.55 g/mol. Its IUPAC name is (3Z,5Z)-5,6-dimethyl-2-methylidene-N-[1-[8-(2-methylprop-2-enyl)-6H-pyrazolo[1,5-a][1,3]diazepin-5-yl]ethenyl]octa-3,5-dien-1-amine.
| Compound Name | (3Z,5Z)-5,6-dimethyl-2-methylidene-N-[1-[8-(2-methylprop-2-enyl)-6H-pyrazolo[1,5-a][1,3]diazepin-5-yl]ethenyl]octa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143345771 |
| Molecular Formula | C24H32N4 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (3Z,5Z)-5,6-dimethyl-2-methylidene-N-[1-[8-(2-methylprop-2-enyl)-6H-pyrazolo[1,5-a][1,3]diazepin-5-yl]ethenyl]octa-3,5-dien-1-amine |
| SMILES | C=C(C)CC1=CCC(C(=C)NCC(=C)/C=C\C(C)=C(\C)CC)=Nc2ccnn21 |
| InChI | InChI=1S/C24H32N4/c1-8-19(5)20(6)10-9-18(4)16-25-21(7)23-12-11-22(15-17(2)3)28-24(27-23)13-14-26-28/h9-11,13-14,25H,2,4,7-8,12,15-16H2,1,3,5-6H3/b10-9-,20-19- |
| InChIKey | HMHGTOWEIUPFFJ-JMOFRJKPSA-N |
| XLogP | 6.13 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|