C11H16N4 — CID 143818183
1-(2-propan-2-yl-1,2-dihydropyridin-5-yl)pyrazol-3-amine (PubChem CID 143818183) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 1-(2-propan-2-yl-1,2-dihydropyridin-5-yl)pyrazol-3-amine.
| Compound Name | 1-(2-propan-2-yl-1,2-dihydropyridin-5-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 143818183 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 1-(2-propan-2-yl-1,2-dihydropyridin-5-yl)pyrazol-3-amine |
| SMILES | CC(C)C1C=CC(n2ccc(N)n2)=CN1 |
| InChI | InChI=1S/C11H16N4/c1-8(2)10-4-3-9(7-13-10)15-6-5-11(12)14-15/h3-8,10,13H,1-2H3,(H2,12,14) |
| InChIKey | WGFFTYDVAFLPDZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |