C28H30FNO3 — CID 143091087
tert-butyl 2-[N-(2-ethyl-6-fluorobenzoyl)-3-(2-methylphenyl)anilino]acetate (PubChem CID 143091087) has the molecular formula C28H30FNO3 and a molecular weight of 447.55 g/mol. Its IUPAC name is tert-butyl 2-[N-(2-ethyl-6-fluorobenzoyl)-3-(2-methylphenyl)anilino]acetate.
| Compound Name | tert-butyl 2-[N-(2-ethyl-6-fluorobenzoyl)-3-(2-methylphenyl)anilino]acetate |
|---|---|
| PubChem CID | 143091087 |
| Molecular Formula | C28H30FNO3 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | tert-butyl 2-[N-(2-ethyl-6-fluorobenzoyl)-3-(2-methylphenyl)anilino]acetate |
| SMILES | CCc1cccc(F)c1C(=O)N(CC(=O)OC(C)(C)C)c1cccc(-c2ccccc2C)c1 |
| InChI | InChI=1S/C28H30FNO3/c1-6-20-12-10-16-24(29)26(20)27(32)30(18-25(31)33-28(3,4)5)22-14-9-13-21(17-22)23-15-8-7-11-19(23)2/h7-17H,6,18H2,1-5H3 |
| InChIKey | IRBFKDHHNWUSTR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |