C21H25FN2 — CID 143091794
(2E,3Z)-5-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-1-yl]-2-ethylidenehexa-3,5-dienenitrile;fluoromethane (PubChem CID 143091794) has the molecular formula C21H25FN2 and a molecular weight of 324.44 g/mol. Its IUPAC name is (2E,3Z)-5-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-1-yl]-2-ethylidenehexa-3,5-dienenitrile;fluoromethane.
| Compound Name | (2E,3Z)-5-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-1-yl]-2-ethylidenehexa-3,5-dienenitrile;fluoromethane |
|---|---|
| PubChem CID | 143091794 |
| Molecular Formula | C21H25FN2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (2E,3Z)-5-[(1R,5S)-3-benzyl-3-azabicyclo[3.1.0]hexan-1-yl]-2-ethylidenehexa-3,5-dienenitrile;fluoromethane |
| SMILES | C=C(/C=C\C(C#N)=C/C)[C@@]12C[C@@H]1CN(Cc1ccccc1)C2.CF |
| InChI | InChI=1S/C20H22N2.CH3F/c1-3-17(12-21)10-9-16(2)20-11-19(20)14-22(15-20)13-18-7-5-4-6-8-18;1-2/h3-10,19H,2,11,13-15H2,1H3;1H3/b10-9-,17-3+;/t19-,20+;/m1./s1 |
| InChIKey | PACDFQMUSSNNIW-SIFYTAKKSA-N |
| XLogP | 4.68 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|