C13H18N2O2 — CID 143092013
1,2-dimethylindol-5-amine;2-methoxyacetaldehyde (PubChem CID 143092013) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1,2-dimethylindol-5-amine;2-methoxyacetaldehyde.
| Compound Name | 1,2-dimethylindol-5-amine;2-methoxyacetaldehyde |
|---|---|
| PubChem CID | 143092013 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1,2-dimethylindol-5-amine;2-methoxyacetaldehyde |
| SMILES | COCC=O.Cc1cc2cc(N)ccc2n1C |
| InChI | InChI=1S/C10H12N2.C3H6O2/c1-7-5-8-6-9(11)3-4-10(8)12(7)2;1-5-3-2-4/h3-6H,11H2,1-2H3;2H,3H2,1H3 |
| InChIKey | AMENABZNWPNITA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|